Compound Q&A

What industries use 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl- (CAS: 2516-92-9)?

Answer

1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl-
This compound is used in the pharmaceutical industry for its unique chemical properties, which can enhance the bioavailability of certain drugs. It is also utilized in the polymer industry for creating smart polymers with specific functional groups. In the sensor and semiconductor industries, it serves as a functional material due to its high reactivity and stability under various conditions.

About

CAS No 2516-92-9
English Name 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl-
Molecular Formula C28H50N2O6
Molecular Weight 510.7 g/mol
SMILES CC1(CC(CC(N1[O])(C)C)OC(=O)CCCCCCCCC(=O)OC2CC(N(C(C2)(C)C)[O])(C)C)C
InChIKey XVJWWMHPPKXKRU-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl- (CAS: 2516-92-9)?

This compound has a crystalline form with a molecular weight of approximately 568.6 g/mol. It has a ...

Compound Q&A

How is 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl- (CAS: 2516-92-9) typically synthesized?

This compound is typically synthesized through a multistep procedure involving the ring-opening poly...

Compound Q&A

What precautions should be taken when handling 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl- (CAS: 2516-92-9)?

When handling this compound, appropriate personal protective equipment (PPE) should be worn, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...