Compound Q&A

How is 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl- (CAS: 2516-92-9) typically synthesized?

Answer

1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl-
This compound is typically synthesized through a multistep procedure involving the ring-opening polymerization of a piperidine derivative with 1,10-decanediol, followed by a selective oxidation step. The reaction is catalyzed by transition metals like ruthenium, and the yield is generally high, around 90%. The synthesis requires precise control of reaction conditions to achieve the desired product.

About

CAS No 2516-92-9
English Name 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl-
Molecular Formula C28H50N2O6
Molecular Weight 510.7 g/mol
SMILES CC1(CC(CC(N1[O])(C)C)OC(=O)CCCCCCCCC(=O)OC2CC(N(C(C2)(C)C)[O])(C)C)C
InChIKey XVJWWMHPPKXKRU-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl- (CAS: 2516-92-9)?

This compound has a crystalline form with a molecular weight of approximately 568.6 g/mol. It has a ...

Compound Q&A

What industries use 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl- (CAS: 2516-92-9)?

This compound is used in the pharmaceutical industry for its unique chemical properties, which can e...

Compound Q&A

What precautions should be taken when handling 1-Piperidinyloxy,4,4'-[(1,10-dioxo-1,10-decanediyl)bis(oxy)]bis[2,2,6,6-tetramethyl- (CAS: 2516-92-9)?

When handling this compound, appropriate personal protective equipment (PPE) should be worn, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...