Compound Q&A

What industries use Rebaudioside F (CAS: 438045-89-7)?

Answer

Rebaudioside F
Rebaudioside F (CAS: 438045-89-7) is widely used in the food and beverage industry due to its intense sweetness and low caloric value. It is also utilized in the pharmaceutical industry for its sweetening properties and potential health benefits. Additionally, it can be found in the polymer industry as a sweetener in polymer coatings and adhesives.

About

English Name Rebaudioside F
Molecular Formula C43H68O22
Molecular Weight 936.99 g/mol
SMILES CC12CCCC(C1CCC34C2CCC(C3)(C(=C)C4)OC5C(C(C(C(O5)CO)O)OC6C(C(C(C(O6)CO)O)O)O)OC7C(C(C(CO7)O)O)O)(C)C(=O)OC8C(C(C(C(O8)CO)O)O)O
InChIKey QRGRAFPOLJOGRV-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rebaudioside F (CAS: 438045-89-7)?

Rebaudioside F (CAS: 438045-89-7) is a sweet-tasting carbohydrate with a crystalline form. It has a ...

Compound Q&A

How is Rebaudioside F (CAS: 438045-89-7) typically synthesized?

Rebaudioside F (CAS: 438045-89-7) is typically synthesized through enzymatic hydrolysis of Steviol g...

Compound Q&A

What precautions should be taken when handling Rebaudioside F (CAS: 438045-89-7)?

When handling Rebaudioside F (CAS: 438045-89-7), it is important to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...