Compound Q&A

What industries use 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2)?

Answer

8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one
8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2) finds applications in the pharmaceutical industry due to its potential biological activity. It is also used in the semiconductor industry as a precursor for the synthesis of functional materials. Additionally, it has applications in the development of sensors and as a research reagent in organic synthesis.

About

CAS No 20749-68-2
English Name 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one
Molecular Formula C18H6Cl4N2O
Molecular Weight 408.07 g/mol
SMILES C1=CC2=C3C(=C1)N=C4C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)N4C3=CC=C2
InChIKey UBZVRROHBDDCQY-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2)?

8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2) is a crystalline solid ...

Compound Q&A

How is 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2) typically synthesized?

8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2) is typically synthesize...

Compound Q&A

What precautions should be taken when handling 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2)?

When handling 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2), it is cr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...