Compound Q&A

What are the physical and chemical properties of 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2)?

Answer

8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one
8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2) is a crystalline solid with a molecular weight of approximately 364.03 g/mol. It is poorly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound is highly reactive due to its multiple halogen substitutions and can undergo various chemical transformations. It has a melting point of about 160-165°C and is stable under normal laboratory conditions.

About

CAS No 20749-68-2
English Name 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one
Molecular Formula C18H6Cl4N2O
Molecular Weight 408.07 g/mol
SMILES C1=CC2=C3C(=C1)N=C4C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)N4C3=CC=C2
InChIKey UBZVRROHBDDCQY-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2) typically synthesized?

8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2) is typically synthesize...

Compound Q&A

What industries use 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2)?

8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2) finds applications in t...

Compound Q&A

What precautions should be taken when handling 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2)?

When handling 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one (CAS: 20749-68-2), it is cr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...