Compound Q&A

How is 1,2,4,5-Cyclohexanetetracarboxylic acid (CAS: 15383-49-0) typically synthesized?

Answer

1,2,4,5-Cyclohexanetetracarboxylic acid
1,2,4,5-Cyclohexanetetracarboxylic acid can be synthesized via the diels-aldol condensation of maleic anhydride with cyclohexene. The reaction requires a catalyst, such as a transition metal complex, and provides a yield of around 80-90%. The selectivity towards the desired product is high.

About

CAS No 15383-49-0
English Name 1,2,4,5-Cyclohexanetetracarboxylic acid
Molecular Formula C10H12O8
Molecular Weight 260.2 g/mol
SMILES C1C(C(CC(C1C(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey ZPAKUZKMGJJMAA-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,4,5-Cyclohexanetetracarboxylic acid (CAS: 15383-49-0)?

1,2,4,5-Cyclohexanetetracarboxylic acid is a crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 1,2,4,5-Cyclohexanetetracarboxylic acid (CAS: 15383-49-0)?

1,2,4,5-Cyclohexanetetracarboxylic acid is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 1,2,4,5-Cyclohexanetetracarboxylic acid (CAS: 15383-49-0)?

When handling 1,2,4,5-Cyclohexanetetracarboxylic acid, proper personal protective equipment (PPE) sh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...