Compound Q&A

What are the physical and chemical properties of 1,2,4,5-Cyclohexanetetracarboxylic acid (CAS: 15383-49-0)?

Answer

1,2,4,5-Cyclohexanetetracarboxylic acid
1,2,4,5-Cyclohexanetetracarboxylic acid is a crystalline solid with a molecular weight of approximately 224.19 g/mol. It is practically insoluble in water but soluble in common organic solvents like ethanol and acetone. The compound is moderately reactive, showing basic properties due to its carboxylic acid groups.

About

CAS No 15383-49-0
English Name 1,2,4,5-Cyclohexanetetracarboxylic acid
Molecular Formula C10H12O8
Molecular Weight 260.2 g/mol
SMILES C1C(C(CC(C1C(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey ZPAKUZKMGJJMAA-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 1,2,4,5-Cyclohexanetetracarboxylic acid (CAS: 15383-49-0) typically synthesized?

1,2,4,5-Cyclohexanetetracarboxylic acid can be synthesized via the diels-aldol condensation of malei...

Compound Q&A

What industries use 1,2,4,5-Cyclohexanetetracarboxylic acid (CAS: 15383-49-0)?

1,2,4,5-Cyclohexanetetracarboxylic acid is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 1,2,4,5-Cyclohexanetetracarboxylic acid (CAS: 15383-49-0)?

When handling 1,2,4,5-Cyclohexanetetracarboxylic acid, proper personal protective equipment (PPE) sh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...