Compound Q&A

What industries use (4-Nitrophenyl)(phenyl)methanone (CAS: 1144-74-7)?

Answer

(4-Nitrophenyl)(phenyl)methanone
(4-Nitrophenyl)(phenyl)methanone is primarily used in the pharmaceutical industry for the synthesis of various compounds and intermediates. It is also utilized in the polymer industry for the development of specific polymers and in the electronics sector for the production of semiconductor materials. Additionally, it finds applications in the synthesis of certain dyes and as a reagent in analytical chemistry.

About

CAS No 1144-74-7
English Name (4-Nitrophenyl)(phenyl)methanone
Molecular Formula C13H9NO3
Molecular Weight 227.21 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey ZYMCBJWUWHHVRX-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Nitrophenyl)(phenyl)methanone (CAS: 1144-74-7)?

(4-Nitrophenyl)(phenyl)methanone is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is (4-Nitrophenyl)(phenyl)methanone (CAS: 1144-74-7) typically synthesized?

(4-Nitrophenyl)(phenyl)methanone can be synthesized through a condensation reaction of 4-nitrophenol...

Compound Q&A

What precautions should be taken when handling (4-Nitrophenyl)(phenyl)methanone (CAS: 1144-74-7)?

When handling (4-Nitrophenyl)(phenyl)methanone, appropriate personal protective equipment (PPE) shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...