Compound Q&A

What are the physical and chemical properties of (4-Nitrophenyl)(phenyl)methanone (CAS: 1144-74-7)?

Answer

(4-Nitrophenyl)(phenyl)methanone
(4-Nitrophenyl)(phenyl)methanone is a crystalline compound with a molecular weight of approximately 243.13 g/mol. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with reducing agents. It has a melting point of about 110-112°C and a boiling point of around 252-254°C under normal pressure.

About

CAS No 1144-74-7
English Name (4-Nitrophenyl)(phenyl)methanone
Molecular Formula C13H9NO3
Molecular Weight 227.21 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey ZYMCBJWUWHHVRX-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is (4-Nitrophenyl)(phenyl)methanone (CAS: 1144-74-7) typically synthesized?

(4-Nitrophenyl)(phenyl)methanone can be synthesized through a condensation reaction of 4-nitrophenol...

Compound Q&A

What industries use (4-Nitrophenyl)(phenyl)methanone (CAS: 1144-74-7)?

(4-Nitrophenyl)(phenyl)methanone is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling (4-Nitrophenyl)(phenyl)methanone (CAS: 1144-74-7)?

When handling (4-Nitrophenyl)(phenyl)methanone, appropriate personal protective equipment (PPE) shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...