Compound Q&A

What industries use 1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt (CAS: 887-76-3)?

Answer

1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt
1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt is used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. It is also utilized in the production of dyes and pigments, as a precursor in organic synthesis, and as a reagent in analytical chemistry for spectroscopic studies and as a sensitizer in photochemistry.

About

CAS No 887-76-3
English Name 1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt
Molecular Formula C10H6N2O4S
Molecular Weight 252.25 g/mol
EINECS 212-958-9
SMILES C1=CC=C2C(=C1)C(=CC(=C2[N+]#N)O)S(=O)(=O)[O-]
InChIKey QHIBNGIZPPHJAT-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt (CAS: 887-76-3)?

1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt has a crystalline form and a molecular weight...

Compound Q&A

How is 1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt (CAS: 887-76-3) typically synthesized?

1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt is typically synthesized by diazotization of ...

Compound Q&A

What precautions should be taken when handling 1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt (CAS: 887-76-3)?

When handling 1-naphthalenediazonium, 2-hydroxy-4-sulfo-, inner salt, use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...