Compound Q&A

What industries use (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid (CAS: 78285-90-2)?

Answer

(3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid
This compound is used in the pharmaceutical industry for its potential as a natural product lead in drug discovery. It is also used in the food industry for its antioxidant properties and as a dietary supplement. Additionally, it can be used in the cosmetic industry for its potential skin benefits.

About

CAS No 78285-90-2
English Name (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid
Molecular Formula C36H58O9
Molecular Weight 634.85 g/mol
SMILES CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)CO)O)O)O)C)C(=O)O)C
InChIKey WYDPEADEZMZKNM-ZBKPBKBGSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid (CAS: 78285-90-2)?

The compound has a crystalline form and a molecular weight of approximately 866.96 g/mol. It is slig...

Compound Q&A

How is (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid (CAS: 78285-90-2) typically synthesized?

This compound is typically synthesized through the glycosylation of 16-hydroxyolean-12-en-28-oic aci...

Compound Q&A

What precautions should be taken when handling (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid (CAS: 78285-90-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...