Compound Q&A

What are the physical and chemical properties of (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid (CAS: 78285-90-2)?

Answer

(3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid
The compound has a crystalline form and a molecular weight of approximately 866.96 g/mol. It is slightly soluble in organic solvents such as ethanol and acetone. Chemically, it is reactive towards acid and base catalyzed hydrolysis, and can undergo esterification and other condensation reactions. It is stable under neutral conditions but should be stored away from strong acids and bases.

About

CAS No 78285-90-2
English Name (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid
Molecular Formula C36H58O9
Molecular Weight 634.85 g/mol
SMILES CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)CO)O)O)O)C)C(=O)O)C
InChIKey WYDPEADEZMZKNM-ZBKPBKBGSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid (CAS: 78285-90-2) typically synthesized?

This compound is typically synthesized through the glycosylation of 16-hydroxyolean-12-en-28-oic aci...

Compound Q&A

What industries use (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid (CAS: 78285-90-2)?

This compound is used in the pharmaceutical industry for its potential as a natural product lead in ...

Compound Q&A

What precautions should be taken when handling (3beta,16alpha)-3-(beta-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid (CAS: 78285-90-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...