Compound Q&A

What are the physical and chemical properties of CETUXIMAB (CAS: 205923-56-4)?

Answer

CETUXIMAB
Cetuximab is a monoclonal antibody with a molecular weight of approximately 145 kDa. It is a protein that is typically produced in a crystalline form. Cetuximab has a low solubility in water and is relatively stable. It does not react with common inorganic acids or bases but may be susceptible to degradation under harsh conditions. Its stability and solubility make it suitable for pharmaceutical applications.

About

English Name CETUXIMAB
Molecular Weight 354.29 g/mol
SMILES Br.OC(CCCCCN1C(=C)C(C)(C)C2=CC=CC=C12)=O
InChIKey SVMKEDBUSSWSFY-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is CETUXIMAB (CAS: 205923-56-4) typically synthesized?

Cetuximab is synthesized through a complex process involving hybridoma technology. The antibody is p...

Compound Q&A

What industries use CETUXIMAB (CAS: 205923-56-4)?

Cetuximab is primarily used in the pharmaceutical industry, particularly in oncology. It is used as ...

Compound Q&A

What precautions should be taken when handling CETUXIMAB (CAS: 205923-56-4)?

Proper handling of cetuximab requires the use of personal protective equipment (PPE) such as gloves ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...