Compound Q&A

How is (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 164298-23-1) typically synthesized?

Answer

(Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate
This compound can be synthesized via the reaction of dimethylformamide and hexafluorophosphoric acid in the presence of a suitable catalyst, such as triethylamine. The synthesis typically yields a high purity product with good selectivity and yield, making it a valuable reagent in organic synthesis.

About

English Name (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate
Molecular Formula C5H12F7N2P
Molecular Weight 264.12 g/mol
SMILES CN(C)C(=[N+](C)C)F.F[P-](F)(F)(F)(F)F
InChIKey ZAVXOOLKAGPJPI-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 164298-23-1)?

The compound is a crystalline solid with a molecular weight of approximately 579.6 g/mol. It has a l...

Compound Q&A

What industries use (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 164298-23-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various organic ...

Compound Q&A

What precautions should be taken when handling (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 164298-23-1)?

This compound should be handled in a well-ventilated area or fume hood due to its volatile nature an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...