Compound Q&A

What are the physical and chemical properties of (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 164298-23-1)?

Answer

(Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate
The compound is a crystalline solid with a molecular weight of approximately 579.6 g/mol. It has a low solubility in water but is soluble in organic solvents. It is highly reactive due to the presence of fluorine and aminium groups. Reactivity is sensitive to moisture and air, requiring careful handling and storage under inert conditions.

About

English Name (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate
Molecular Formula C5H12F7N2P
Molecular Weight 264.12 g/mol
SMILES CN(C)C(=[N+](C)C)F.F[P-](F)(F)(F)(F)F
InChIKey ZAVXOOLKAGPJPI-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 164298-23-1) typically synthesized?

This compound can be synthesized via the reaction of dimethylformamide and hexafluorophosphoric acid...

Compound Q&A

What industries use (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 164298-23-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various organic ...

Compound Q&A

What precautions should be taken when handling (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate (CAS: 164298-23-1)?

This compound should be handled in a well-ventilated area or fume hood due to its volatile nature an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...