Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 114214-69-6)?

Answer

2-Methyl-2-propanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 114214-69-6) is a colorless or white crystalline solid. It has a molecular weight of approximately 224.3 g/mol and a solubility of about 1.5 g/L in water. This compound is moderately reactive, particularly towards nucleophiles and bases. It is poorly soluble in water but has good solubility in organic solvents like ethanol and acetonitrile.

About

English Name 2-Methyl-2-propanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate
Molecular Formula C10H19NO3
Molecular Weight 201.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)CO
InChIKey HKIGXXRMJFUUKV-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 114214-69-6) typically synthesized?

2-Methyl-2-propanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 114214-69-6) is typically synth...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 114214-69-6)?

2-Methyl-2-propanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 114214-69-6) is utilized in the...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 114214-69-6)?

When handling 2-Methyl-2-proanyl 3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 114214-69-6), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...