Compound Q&A

What industries use 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5)?

Answer

1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone
1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5) is used in various industries due to its functional groups. It is primarily utilized in pharmaceuticals for the synthesis of various drugs, in polymers as a stabilizer, and in sensors for detecting specific chemical species. Additionally, it has applications in the semiconductor industry for etching processes.

About

CAS No 116-82-5
English Name 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone
Molecular Formula C14H8BrNO3
Molecular Weight 318.13 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3O)Br)N
InChIKey MSSQDESMUMSQEN-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5)?

1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5) is a crystalline solid with a molecular...

Compound Q&A

How is 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5) typically synthesized?

1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5) is typically synthesized through a mult...

Compound Q&A

What precautions should be taken when handling 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5)?

When handling 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...