Compound Q&A

What are the physical and chemical properties of 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5)?

Answer

1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone
1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5) is a crystalline solid with a molecular weight of approximately 349.04 g/mol. It is slightly soluble in water and less soluble in common organic solvents like ethanol and acetone. The compound exhibits moderate reactivity, particularly in its bromine functionality, making it prone to nucleophilic substitution reactions.

About

CAS No 116-82-5
English Name 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone
Molecular Formula C14H8BrNO3
Molecular Weight 318.13 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3O)Br)N
InChIKey MSSQDESMUMSQEN-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5) typically synthesized?

1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5) is typically synthesized through a mult...

Compound Q&A

What industries use 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5)?

1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5) is used in various industries due to it...

Compound Q&A

What precautions should be taken when handling 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5)?

When handling 1-Amino-2-bromo-4-hydroxy-9,10-anthraquinone (CAS: 116-82-5), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...