Compound Q&A

What industries use epinastine hydrochloride (CAS: 80012-44-8)?

Answer

Epinastine Hydrochloride
Epinastine hydrochloride is primarily used in the pharmaceutical industry for its antihistaminic properties. It is also used in some light industries for its chemical reactivity. Its applications include the formulation of allergy medications and as a research compound for drug development.

About

CAS No 80012-44-8
English Name Epinastine Hydrochloride
Molecular Formula C16H16ClN3
Molecular Weight 285.77 g/mol
SMILES C1C2C3=CC=CC=C3CC4=CC=CC=C4N2C(=N1)N.Cl
InChIKey VKXSGUIOOQPGAF-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of epinastine hydrochloride (CAS: 80012-44-8)?

Epinastine hydrochloride is a white to off-white crystalline powder with a molecular weight of appro...

Compound Q&A

How is epinastine hydrochloride (CAS: 80012-44-8) typically synthesized?

Epinastine hydrochloride can be synthesized from epinastine by reacting it with hydrochloric acid. T...

Compound Q&A

What precautions should be taken when handling epinastine hydrochloride (CAS: 80012-44-8)?

When handling epinastine hydrochloride, wear appropriate personal protective equipment (PPE), includ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...