Compound Q&A

What industries use 3,7-Diaminophenothiazin-5-ium acetate (CAS: 78338-22-4)?

Answer

3,7-Diaminophenothiazin-5-ium acetate
3,7-Diaminophenothiazin-5-ium acetate is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for the production of special polymers, and in the sensor industry for the development of conductive materials. It is also used in semiconductor applications for its electronic properties.

About

CAS No 78338-22-4
English Name 3,7-Diaminophenothiazin-5-ium acetate
Molecular Formula C14H13N3O2S
Molecular Weight 287.34 g/mol
SMILES CC(=O)[O-].C1=CC2=C(C=C1N)SC3=CC(=[NH2+])C=CC3=N2
InChIKey OWXBIRAFHWASMS-UHFFFAOYSA-M
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,7-Diaminophenothiazin-5-ium acetate (CAS: 78338-22-4)?

3,7-Diaminophenothiazin-5-ium acetate is a white or off-white crystalline solid with a molecular wei...

Compound Q&A

How is 3,7-Diaminophenothiazin-5-ium acetate (CAS: 78338-22-4) typically synthesized?

3,7-Diaminophenothiazin-5-ium acetate is usually synthesized by the acetylation of 3,7-diaminophenot...

Compound Q&A

What precautions should be taken when handling 3,7-Diaminophenothiazin-5-ium acetate (CAS: 78338-22-4)?

When handling 3,7-Diaminophenothiazin-5-ium acetate, it is essential to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...