Compound Q&A

What are the physical and chemical properties of 3,7-Diaminophenothiazin-5-ium acetate (CAS: 78338-22-4)?

Answer

3,7-Diaminophenothiazin-5-ium acetate
3,7-Diaminophenothiazin-5-ium acetate is a white or off-white crystalline solid with a molecular weight of approximately 268.23 g/mol. It is slightly soluble in water and ethanol. Chemically, it is highly reactive and can undergo substitution and condensation reactions. It has a melting point of around 170°C and a boiling point of about 300°C under vacuum.

About

CAS No 78338-22-4
English Name 3,7-Diaminophenothiazin-5-ium acetate
Molecular Formula C14H13N3O2S
Molecular Weight 287.34 g/mol
SMILES CC(=O)[O-].C1=CC2=C(C=C1N)SC3=CC(=[NH2+])C=CC3=N2
InChIKey OWXBIRAFHWASMS-UHFFFAOYSA-M
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 3,7-Diaminophenothiazin-5-ium acetate (CAS: 78338-22-4) typically synthesized?

3,7-Diaminophenothiazin-5-ium acetate is usually synthesized by the acetylation of 3,7-diaminophenot...

Compound Q&A

What industries use 3,7-Diaminophenothiazin-5-ium acetate (CAS: 78338-22-4)?

3,7-Diaminophenothiazin-5-ium acetate is used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What precautions should be taken when handling 3,7-Diaminophenothiazin-5-ium acetate (CAS: 78338-22-4)?

When handling 3,7-Diaminophenothiazin-5-ium acetate, it is essential to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...