Compound Q&A

How is 2-Ethyl-2-Adamantyl Methacrylate (CAS: 209982-56-9) typically synthesized?

Answer

2-Ethyl-2-Adamantyl Methacrylate
2-Ethyl-2-Adamantyl Methacrylate is synthesized through the methacrylation of 2-ethyl-2-adamantyl alcohol using methacryloyl chloride in the presence of a base like triethylamine. The reaction is carried out at room temperature, and the yield is typically around 70-80% with good selectivity for the methacrylation product.

About

English Name 2-Ethyl-2-Adamantyl Methacrylate
Molecular Formula C16H24O2
Molecular Weight 248.37 g/mol
SMILES CCC1(C2CC3CC(C2)CC1C3)OC(=O)C(=C)C
InChIKey DCTVCFJTKSQXED-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethyl-2-Adamantyl Methacrylate (CAS: 209982-56-9)?

2-Ethyl-2-Adamantyl Methacrylate is a colorless to yellow liquid with a molecular weight of approxim...

Compound Q&A

What industries use 2-Ethyl-2-Adamantyl Methacrylate (CAS: 209982-56-9)?

2-Ethyl-2-Adamantyl Methacrylate is primarily used in the polymer industry for the production of adv...

Compound Q&A

What precautions should be taken when handling 2-Ethyl-2-Adamantyl Methacrylate (CAS: 209982-56-9)?

When handling 2-Ethyl-2-Adamantyl Methacrylate, it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...