Compound Q&A

What are the physical and chemical properties of 2-Ethyl-2-Adamantyl Methacrylate (CAS: 209982-56-9)?

Answer

2-Ethyl-2-Adamantyl Methacrylate
2-Ethyl-2-Adamantyl Methacrylate is a colorless to yellow liquid with a molecular weight of approximately 274.42 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is moderately reactive and undergoes polymerization upon exposure to UV light or heat, which is typical for methacrylate monomers.

About

English Name 2-Ethyl-2-Adamantyl Methacrylate
Molecular Formula C16H24O2
Molecular Weight 248.37 g/mol
SMILES CCC1(C2CC3CC(C2)CC1C3)OC(=O)C(=C)C
InChIKey DCTVCFJTKSQXED-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 2-Ethyl-2-Adamantyl Methacrylate (CAS: 209982-56-9) typically synthesized?

2-Ethyl-2-Adamantyl Methacrylate is synthesized through the methacrylation of 2-ethyl-2-adamantyl al...

Compound Q&A

What industries use 2-Ethyl-2-Adamantyl Methacrylate (CAS: 209982-56-9)?

2-Ethyl-2-Adamantyl Methacrylate is primarily used in the polymer industry for the production of adv...

Compound Q&A

What precautions should be taken when handling 2-Ethyl-2-Adamantyl Methacrylate (CAS: 209982-56-9)?

When handling 2-Ethyl-2-Adamantyl Methacrylate, it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...