Compound Q&A

How is N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8) typically synthesized?

Answer

N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide
N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8) is typically synthesized via a multi-step process involving the formation of an intermediate amide followed by the introduction of the chloro-pyridine moiety and cyano group. The reaction is often carried out in polar aprotic solvents using appropriate protecting groups and catalysts. Yields are generally around 70-80% depending on the specific reaction conditions.

About

English Name N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide
Molecular Formula C10H11ClN4
Molecular Weight 222.67 g/mol
SMILES CC(=NC#N)N(C)Cc1ccc(nc1)Cl
InChIKey WCXDHFDTOYPNIE-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8)?

N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8) is a crystalline...

Compound Q&A

What industries use N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8)?

N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8) is used in the p...

Compound Q&A

What precautions should be taken when handling N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8)?

When handling N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...