Compound Q&A

What are the physical and chemical properties of N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8)?

Answer

N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide
N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8) is a crystalline solid with a molecular weight of approximately 291.17 g/mol. It has a low solubility in water but is more soluble in organic solvents like DMSO and DMF. The compound is moderately reactive, particularly towards nucleophiles. It can be characterized by its infrared (IR) and nuclear magnetic resonance (NMR) spectroscopic data.

About

English Name N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide
Molecular Formula C10H11ClN4
Molecular Weight 222.67 g/mol
SMILES CC(=NC#N)N(C)Cc1ccc(nc1)Cl
InChIKey WCXDHFDTOYPNIE-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8) typically synthesized?

N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8) is typically syn...

Compound Q&A

What industries use N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8)?

N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8) is used in the p...

Compound Q&A

What precautions should be taken when handling N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8)?

When handling N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (CAS: 160430-64-8), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...