Compound Q&A

How is (3,4-Dimethylphenyl)(phenyl)methanone (CAS: 2571-39-3) typically synthesized?

Answer

(3,4-Dimethylphenyl)(phenyl)methanone
(3,4-Dimethylphenyl)(phenyl)methanone is often synthesized through a condensation reaction between phenylmethyl ketone and 3,4-dimethylbenzaldehyde. The reaction is typically conducted in the presence of a base such as sodium hydroxide to facilitate the formation of the desired product. The yield and selectivity of the reaction are generally high, making this a reliable method for industrial production.

About

CAS No 2571-39-3
English Name (3,4-Dimethylphenyl)(phenyl)methanone
Molecular Formula C15H14O
Molecular Weight 210.28 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)C
InChIKey JENOLWCGNVWTJN-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,4-Dimethylphenyl)(phenyl)methanone (CAS: 2571-39-3)?

(3,4-Dimethylphenyl)(phenyl)methanone is a clear, colorless liquid with a molecular weight of approx...

Compound Q&A

What industries use (3,4-Dimethylphenyl)(phenyl)methanone (CAS: 2571-39-3)?

(3,4-Dimethylphenyl)(phenyl)methanone is used in various industries. It is a key intermediate in the...

Compound Q&A

What precautions should be taken when handling (3,4-Dimethylphenyl)(phenyl)methanone (CAS: 2571-39-3)?

When handling (3,4-Dimethylphenyl)(phenyl)methanone, it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...