Compound Q&A

What are the physical and chemical properties of (3,4-Dimethylphenyl)(phenyl)methanone (CAS: 2571-39-3)?

Answer

(3,4-Dimethylphenyl)(phenyl)methanone
(3,4-Dimethylphenyl)(phenyl)methanone is a clear, colorless liquid with a molecular weight of approximately 242.26 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong acids and bases under certain conditions. Its reactivity is typically low under standard conditions, making it a versatile compound in various chemical processes.

About

CAS No 2571-39-3
English Name (3,4-Dimethylphenyl)(phenyl)methanone
Molecular Formula C15H14O
Molecular Weight 210.28 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)C
InChIKey JENOLWCGNVWTJN-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is (3,4-Dimethylphenyl)(phenyl)methanone (CAS: 2571-39-3) typically synthesized?

(3,4-Dimethylphenyl)(phenyl)methanone is often synthesized through a condensation reaction between p...

Compound Q&A

What industries use (3,4-Dimethylphenyl)(phenyl)methanone (CAS: 2571-39-3)?

(3,4-Dimethylphenyl)(phenyl)methanone is used in various industries. It is a key intermediate in the...

Compound Q&A

What precautions should be taken when handling (3,4-Dimethylphenyl)(phenyl)methanone (CAS: 2571-39-3)?

When handling (3,4-Dimethylphenyl)(phenyl)methanone, it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...