Compound Q&A

What industries use 3-Acetylphenyl acetate (CAS: 2454-35-5)?

Answer

3-Acetylphenyl acetate
3-Acetylphenyl acetate (CAS: 2454-35-5) is primarily used in the pharmaceutical and fine chemical industries as a starting material for the synthesis of dyes and pigments. It is also utilized in the polymer industry for modifying properties of polymers. Additionally, it finds applications in the sensor and semiconductor industries due to its functional groups.

About

CAS No 2454-35-5
English Name 3-Acetylphenyl acetate
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES CC(=O)C1=CC(=CC=C1)OC(=O)C
InChIKey OTHYPAMNTUGKDK-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Acetylphenyl acetate (CAS: 2454-35-5)?

3-Acetylphenyl acetate (CAS: 2454-35-5) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is 3-Acetylphenyl acetate (CAS: 2454-35-5) typically synthesized?

3-Acetylphenyl acetate (CAS: 2454-35-5) is typically synthesized through the esterification reaction...

Compound Q&A

What precautions should be taken when handling 3-Acetylphenyl acetate (CAS: 2454-35-5)?

When handling 3-Acetylphenyl acetate (CAS: 2454-35-5), it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...