Compound Q&A

What are the physical and chemical properties of 3-Acetylphenyl acetate (CAS: 2454-35-5)?

Answer

3-Acetylphenyl acetate
3-Acetylphenyl acetate (CAS: 2454-35-5) is a crystalline compound with a molecular weight of approximately 214.24 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. This compound exhibits moderate reactivity, particularly in ester substitution reactions. It is often used as a precursor in organic synthesis due to its functional groups.

About

CAS No 2454-35-5
English Name 3-Acetylphenyl acetate
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES CC(=O)C1=CC(=CC=C1)OC(=O)C
InChIKey OTHYPAMNTUGKDK-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 3-Acetylphenyl acetate (CAS: 2454-35-5) typically synthesized?

3-Acetylphenyl acetate (CAS: 2454-35-5) is typically synthesized through the esterification reaction...

Compound Q&A

What industries use 3-Acetylphenyl acetate (CAS: 2454-35-5)?

3-Acetylphenyl acetate (CAS: 2454-35-5) is primarily used in the pharmaceutical and fine chemical in...

Compound Q&A

What precautions should be taken when handling 3-Acetylphenyl acetate (CAS: 2454-35-5)?

When handling 3-Acetylphenyl acetate (CAS: 2454-35-5), it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...