Compound Q&A

What are the physical and chemical properties of 2-Methyl-3-nitropyridine (CAS: 18699-87-1)?

Answer

2-Methyl-3-nitropyridine
2-Methyl-3-nitropyridine is a crystalline compound with a molecular weight of approximately 173.12 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and methanol. Chemically, it is relatively stable but can undergo reduction reactions under certain conditions. The compound is often synthesized using nitration of 2-methylpyridine.

About

CAS No 18699-87-1
English Name 2-Methyl-3-nitropyridine
Molecular Formula C6H6N2O2
Molecular Weight 138.12 g/mol
SMILES CC1=C(C=CC=N1)[N+](=O)[O-]
InChIKey CCFGTKQIRWHYTB-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 2-Methyl-3-nitropyridine (CAS: 18699-87-1) typically synthesized?

2-Methyl-3-nitropyridine is usually synthesized by the nitration of 2-methylpyridine in the presence...

Compound Q&A

What industries use 2-Methyl-3-nitropyridine (CAS: 18699-87-1)?

2-Methyl-3-nitropyridine is used in various industries including pharmaceuticals for the synthesis o...

Compound Q&A

What precautions should be taken when handling 2-Methyl-3-nitropyridine (CAS: 18699-87-1)?

When handling 2-Methyl-3-nitropyridine, it is important to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...