Compound Q&A

What precautions should be taken when handling SolventRed179 (CAS: 89106-94-5)?

Answer

SolventRed179
When handling SolventRed179 (CAS: 89106-94-5), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or fume hood to minimize inhalation risks. Spills should be immediately cleaned with suitable absorbents, and proper disposal methods should be followed as outlined in the safety data sheet (SDS).

About

CAS No 89106-94-5
English Name SolventRed179
Molecular Formula C12H26N4O2
Molecular Weight 258.36 g/mol
SMILES C(CCCCCNC(=O)N)CCCCNC(=O)N
InChIKey MOUJWRXYUCHBOI-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of SolventRed179 (CAS: 89106-94-5)?

SolventRed179 (CAS: 89106-94-5) is a deep red crystalline compound with a molecular weight of approx...

Compound Q&A

How is SolventRed179 (CAS: 89106-94-5) typically synthesized?

SolventRed179 (CAS: 89106-94-5) is synthesized through a series of reactions involving aromatic subs...

Compound Q&A

What industries use SolventRed179 (CAS: 89106-94-5)?

SolventRed179 (CAS: 89106-94-5) is primarily used in the dye and pigment industry for its deep red c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...