Compound Q&A

What are the physical and chemical properties of SolventRed179 (CAS: 89106-94-5)?

Answer

SolventRed179
SolventRed179 (CAS: 89106-94-5) is a deep red crystalline compound with a molecular weight of approximately 420.4 g/mol. It has good solubility in common organic solvents such as ethanol and acetone but is poorly soluble in water. Chemically, it is stable under normal conditions but can react with strong oxidizing agents, making it important to handle with care.

About

CAS No 89106-94-5
English Name SolventRed179
Molecular Formula C12H26N4O2
Molecular Weight 258.36 g/mol
SMILES C(CCCCCNC(=O)N)CCCCNC(=O)N
InChIKey MOUJWRXYUCHBOI-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is SolventRed179 (CAS: 89106-94-5) typically synthesized?

SolventRed179 (CAS: 89106-94-5) is synthesized through a series of reactions involving aromatic subs...

Compound Q&A

What industries use SolventRed179 (CAS: 89106-94-5)?

SolventRed179 (CAS: 89106-94-5) is primarily used in the dye and pigment industry for its deep red c...

Compound Q&A

What precautions should be taken when handling SolventRed179 (CAS: 89106-94-5)?

When handling SolventRed179 (CAS: 89106-94-5), it is crucial to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...