Compound Q&A

What industries use Benzyl L-valinate 4-methylbenzenesulfonate (1:1) (CAS: 16652-76-9)?

Answer

Benzyl L-valinate 4-methylbenzenesulfonate (1:1)
Benzyl L-valinate 4-methylbenzenesulfonate (1:1) is primarily used in the pharmaceutical industry due to its chiral nature, which can be utilized in drug synthesis. It is also explored in the polymer industry for its potential use as a monomer or additive. Additionally, it has applications in the sensor industry for its reactivity and in the semiconductor industry for its electronic properties.

About

CAS No 16652-76-9
English Name Benzyl L-valinate 4-methylbenzenesulfonate (1:1)
Molecular Formula C19H25NO5S
Molecular Weight 379.48 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)C(C(=O)OCC1=CC=CC=C1)N
InChIKey QWUQVUDPBXFOKF-MERQFXBCSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl L-valinate 4-methylbenzenesulfonate (1:1) (CAS: 16652-76-9)?

Benzyl L-valinate 4-methylbenzenesulfonate (1:1) is a crystalline compound with a molecular weight o...

Compound Q&A

How is Benzyl L-valinate 4-methylbenzenesulfonate (1:1) (CAS: 16652-76-9) typically synthesized?

Benzyl L-valinate 4-methylbenzenesulfonate (1:1) is commonly synthesized by reacting benzyl L-valina...

Compound Q&A

What precautions should be taken when handling Benzyl L-valinate 4-methylbenzenesulfonate (1:1) (CAS: 16652-76-9)?

When handling Benzyl L-valinate 4-methylbenzenesulfonate (1:1), it is crucial to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...