Compound Q&A

What are the physical and chemical properties of Albendazole Impurity 5 (CAS: 54029-45-7)?

Answer

Albendazole Impurity 5 (2-Nitro-4-Thiocyanatoaniline)
Albendazole Impurity 5 (CAS: 54029-45-7) is a crystalline solid with a molecular weight of approximately 213.17 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable but can react with strong oxidizing agents. It is often used as an intermediate in the synthesis of Albendazole, a widely used antihelminthic drug.

About

CAS No 54029-45-7
English Name Albendazole Impurity 5 (2-Nitro-4-Thiocyanatoaniline)
Molecular Formula C7H5N3O2S
Molecular Weight 17.03 g/mol
SMILES C1=CC(=C(C=C1SC#N)[N+](=O)[O-])N
InChIKey QUWHIBBGKKRYFW-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is Albendazole Impurity 5 (CAS: 54029-45-7) typically synthesized?

Albendazole Impurity 5 (CAS: 54029-45-7) is typically synthesized through a multi-step process invol...

Compound Q&A

What industries use Albendazole Impurity 5 (CAS: 54029-45-7)?

Albendazole Impurity 5 (CAS: 54029-45-7) is primarily used in the pharmaceutical industry as an inte...

Compound Q&A

What precautions should be taken when handling Albendazole Impurity 5 (CAS: 54029-45-7)?

When handling Albendazole Impurity 5 (CAS: 54029-45-7), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...