Compound Q&A

What are the physical and chemical properties of 5-Fluorouridine (CAS: 316-46-1)?

Answer

5-Fluorouridine
5-Fluorouridine is a white crystalline powder with a molecular weight of 188.03 g/mol. It is soluble in ethanol, methanol, and water, but less so in organic solvents like chloroform. Chemically, it is a nucleoside derivative with good reactivity towards nucleophilic substitution reactions, making it a key intermediate in the synthesis of antiviral and anticancer drugs.

About

CAS No 316-46-1
English Name 5-Fluorouridine
Molecular Formula C9H11FN2O6
Molecular Weight 262.19 g/mol
SMILES C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)F
InChIKey FHIDNBAQOFJWCA-UAKXSSHOSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 5-Fluorouridine (CAS: 316-46-1) typically synthesized?

5-Fluorouridine is commonly synthesized through the reaction of 5-fluorouracil with uridine-5'-monop...

Compound Q&A

What industries use 5-Fluorouridine (CAS: 316-46-1)?

5-Fluorouridine is primarily used in the pharmaceutical industry as an intermediate for the producti...

Compound Q&A

What precautions should be taken when handling 5-Fluorouridine (CAS: 316-46-1)?

When handling 5-Fluorouridine, it is important to use appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...