Compound Q&A

What are the physical and chemical properties of 5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol (CAS: 125-33-7)?

Answer

5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol
5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol (CAS: 125-33-7) is a white crystalline solid with a molecular weight of approximately 232.25 g/mol. It has a high solubility in polar solvents such as methanol and ethanol but is less soluble in water. This compound is relatively stable under normal conditions but can react with strong acids and bases. It is also known for its reactivity towards nucleophiles and electrophiles, making it a useful reagent in organic synthesis.

About

CAS No 125-33-7
English Name 5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol
Molecular Formula C12H14N2O2
Molecular Weight 218.26 g/mol
SMILES CCC1(C(=O)NCNC1=O)C2=CC=CC=C2
InChIKey DQMZLTXERSFNPB-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol (CAS: 125-33-7) typically synthesized?

5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol can be synthesized via the condensation of 5-ethynyl...

Compound Q&A

What industries use 5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol (CAS: 125-33-7)?

5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol (CAS: 125-33-7) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol (CAS: 125-33-7)?

When handling 5-Ethyl-5-phenyl-2,5-dihydro-4,6-pyrimidinediol (CAS: 125-33-7), it is important to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...