Compound Q&A

What industries use 4,5-Dichlorophthalic anhydride (CAS: 942-06-3)?

Answer

4,5-Dichlorophthalic anhydride
4,5-Dichlorophthalic anhydride (CAS: 942-06-3) is used in various industries including pharmaceuticals for synthesizing certain drugs, polymers for manufacturing plastics and resins, and sensors for detecting specific chemical species. Its use in semiconductors is limited but it is explored for certain applications.

About

CAS No 942-06-3
English Name 4,5-Dichlorophthalic anhydride
Molecular Formula C8H2Cl2O3
Molecular Weight 217.01 g/mol
SMILES C1=C2C(=CC(=C1Cl)Cl)C(=O)OC2=O
InChIKey ULSOWUBMELTORB-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dichlorophthalic anhydride (CAS: 942-06-3)?

4,5-Dichlorophthalic anhydride (CAS: 942-06-3) is a crystalline solid at room temperature with a mol...

Compound Q&A

How is 4,5-Dichlorophthalic anhydride (CAS: 942-06-3) typically synthesized?

4,5-Dichlorophthalic anhydride is typically synthesized by the oxidation of 4,5-dichlorophthalic aci...

Compound Q&A

What precautions should be taken when handling 4,5-Dichlorophthalic anhydride (CAS: 942-06-3)?

When handling 4,5-Dichlorophthalic anhydride (CAS: 942-06-3), it is crucial to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...