Compound Q&A

What are the physical and chemical properties of 4,5-Dichlorophthalic anhydride (CAS: 942-06-3)?

Answer

4,5-Dichlorophthalic anhydride
4,5-Dichlorophthalic anhydride (CAS: 942-06-3) is a crystalline solid at room temperature with a molecular weight of approximately 207.01 g/mol. It has a melting point of 134°C and is only slightly soluble in water. It is highly reactive towards amines, alcohols, and other nucleophiles, making it useful in various chemical reactions.

About

CAS No 942-06-3
English Name 4,5-Dichlorophthalic anhydride
Molecular Formula C8H2Cl2O3
Molecular Weight 217.01 g/mol
SMILES C1=C2C(=CC(=C1Cl)Cl)C(=O)OC2=O
InChIKey ULSOWUBMELTORB-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 4,5-Dichlorophthalic anhydride (CAS: 942-06-3) typically synthesized?

4,5-Dichlorophthalic anhydride is typically synthesized by the oxidation of 4,5-dichlorophthalic aci...

Compound Q&A

What industries use 4,5-Dichlorophthalic anhydride (CAS: 942-06-3)?

4,5-Dichlorophthalic anhydride (CAS: 942-06-3) is used in various industries including pharmaceutica...

Compound Q&A

What precautions should be taken when handling 4,5-Dichlorophthalic anhydride (CAS: 942-06-3)?

When handling 4,5-Dichlorophthalic anhydride (CAS: 942-06-3), it is crucial to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...