Compound Q&A

How is Ethyl(triphenyl)phosphonium acetate (CAS: 35835-94-0) typically synthesized?

Answer

Ethyl(triphenyl)phosphonium acetate
Ethyl(triphenyl)phosphonium acetate is typically synthesized by the reaction of triphenylphosphine oxide with ethyl acetate. The reaction involves the esterification of triphenylphosphine oxide with ethyl acetate under mild conditions, yielding a high yield of the target compound without the need for complex catalysts or additional reagents.

About

CAS No 35835-94-0
English Name Ethyl(triphenyl)phosphonium acetate
Molecular Formula C22H23O2P
Molecular Weight 350.4 g/mol
SMILES CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.CC(=O)[O-]
InChIKey HZZUMXSLPJFMCB-UHFFFAOYSA-M
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl(triphenyl)phosphonium acetate (CAS: 35835-94-0)?

Ethyl(triphenyl)phosphonium acetate is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use Ethyl(triphenyl)phosphonium acetate (CAS: 35835-94-0)?

Ethyl(triphenyl)phosphonium acetate is used in various industries such as pharmaceuticals, where it ...

Compound Q&A

What precautions should be taken when handling Ethyl(triphenyl)phosphonium acetate (CAS: 35835-94-0)?

When handling Ethyl(triphenyl)phosphonium acetate, it is important to wear protective gloves, goggle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...