Compound Q&A

What are the physical and chemical properties of Ethyl(triphenyl)phosphonium acetate (CAS: 35835-94-0)?

Answer

Ethyl(triphenyl)phosphonium acetate
Ethyl(triphenyl)phosphonium acetate is a crystalline solid with a molecular weight of approximately 453.3 g/mol. It is soluble in organic solvents such as acetone and chloroform. This compound is reactive and can participate in nucleophilic substitution reactions. It has a melting point of around 90-92°C.

About

CAS No 35835-94-0
English Name Ethyl(triphenyl)phosphonium acetate
Molecular Formula C22H23O2P
Molecular Weight 350.4 g/mol
SMILES CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.CC(=O)[O-]
InChIKey HZZUMXSLPJFMCB-UHFFFAOYSA-M
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is Ethyl(triphenyl)phosphonium acetate (CAS: 35835-94-0) typically synthesized?

Ethyl(triphenyl)phosphonium acetate is typically synthesized by the reaction of triphenylphosphine o...

Compound Q&A

What industries use Ethyl(triphenyl)phosphonium acetate (CAS: 35835-94-0)?

Ethyl(triphenyl)phosphonium acetate is used in various industries such as pharmaceuticals, where it ...

Compound Q&A

What precautions should be taken when handling Ethyl(triphenyl)phosphonium acetate (CAS: 35835-94-0)?

When handling Ethyl(triphenyl)phosphonium acetate, it is important to wear protective gloves, goggle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...