Compound Q&A

What industries use (1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 126534-31-4)?

Answer

(1S)\u200b-\u200b2-\u200bChloro-\u200b1-\u200b(2,\u200b4-\u200bdichlorophenyl)\u200bethanol
(1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is used in various industries, particularly in the pharmaceutical sector for the synthesis of drugs. It is also utilized in the production of certain polymers, where it acts as a monomer or intermediate. Additionally, it can be found in the development of chemical sensors and as a component in semiconductor manufacturing processes.

About

English Name (1S)\u200b-\u200b2-\u200bChloro-\u200b1-\u200b(2,\u200b4-\u200bdichlorophenyl)\u200bethanol
Molecular Formula C8H7Cl3O
Molecular Weight 225.5 g/mol
SMILES ClC[C@H](c1ccc(cc1Cl)Cl)O
InChIKey XHEPANNURIQWRM-MRVPVSSYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 126534-31-4)?

(1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is a crystalline compound with a molecular weight of app...

Compound Q&A

How is (1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 126534-31-4) typically synthesized?

(1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is usually synthesized via the coupling of 2,4-dichlorop...

Compound Q&A

What precautions should be taken when handling (1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 126534-31-4)?

When handling (1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol, it is important to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...