Compound Q&A

Is 7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) safe?

Answer

7-Amino-1,3-naphthalenedisulfonic acid
7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) is generally considered safe when used as directed. However, it should be handled with care due to its potential irritancy to skin and eyes. Protective gloves and safety goggles should be worn during handling.

About

CAS No 86-65-7
English Name 7-Amino-1,3-naphthalenedisulfonic acid
Molecular Formula C10H9NO6S2
Molecular Weight 303.3 g/mol
SMILES C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)S(=O)(=O)O)N
InChIKey CMOLPZZVECHXKN-UHFFFAOYSA-N
Last Updated: 2025-09-28 00:26

Related Q&A

Compound Q&A

What is 7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7)?

7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) is a type of naphthalenedisulfonic acid deriva...

Compound Q&A

What are the main uses of 7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7)?

7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) is primarily used as a pH indicator, a reducin...

Compound Q&A

How should 7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) be stored?

7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) should be stored in a cool, dry place away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...