Compound Q&A

What is 7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7)?

Answer

7-Amino-1,3-naphthalenedisulfonic acid
7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) is a type of naphthalenedisulfonic acid derivative, commonly used in analytical chemistry and dyes. It is a white to light yellow crystalline solid with a pKa of approximately 3.5.

About

CAS No 86-65-7
English Name 7-Amino-1,3-naphthalenedisulfonic acid
Molecular Formula C10H9NO6S2
Molecular Weight 303.3 g/mol
SMILES C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)S(=O)(=O)O)N
InChIKey CMOLPZZVECHXKN-UHFFFAOYSA-N
Last Updated: 2025-09-28 00:26

Related Q&A

Compound Q&A

What are the main uses of 7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7)?

7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) is primarily used as a pH indicator, a reducin...

Compound Q&A

Is 7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) safe?

7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) is generally considered safe when used as dire...

Compound Q&A

How should 7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) be stored?

7-Amino-1,3-naphthalenedisulfonic acid (CAS: 86-65-7) should be stored in a cool, dry place away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...