Compound Q&A

Is 2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) safe?

Answer

2,5-Dimethylbenzenesulfonyl chloride
2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) is generally safe when handled with proper precautions. It is important to follow safety guidelines, including the use of personal protective equipment such as gloves and goggles, and to ensure good ventilation. Spills should be handled with caution, using appropriate safety measures.

About

CAS No 19040-62-1
English Name 2,5-Dimethylbenzenesulfonyl chloride
Molecular Formula C8H9ClO2S
Molecular Weight 204.68 g/mol
SMILES CC1=CC(=C(C=C1)C)S(=O)(=O)Cl
InChIKey FZVZUIBYLZZOEW-UHFFFAOYSA-N
Last Updated: 2025-09-27 16:07

Related Q&A

Compound Q&A

What is 2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1)?

2,5-Dimethylbenzenesulfonyl chloride, also known as 2,5-dimethylbenzenesulfonyl chloride (CAS: 19040...

Compound Q&A

What are the main uses of 2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1)?

2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) is primarily used in organic synthesis, pharm...

Compound Q&A

How should 2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) be stored?

2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...