Compound Q&A

What is 2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1)?

Answer

2,5-Dimethylbenzenesulfonyl chloride
2,5-Dimethylbenzenesulfonyl chloride, also known as 2,5-dimethylbenzenesulfonyl chloride (CAS: 19040-62-1), is a clear, colorless liquid with a pungent odor. It is characterized by its high boiling point and low volatility. This compound is used in various industries for its reactivity and solubility properties.

About

CAS No 19040-62-1
English Name 2,5-Dimethylbenzenesulfonyl chloride
Molecular Formula C8H9ClO2S
Molecular Weight 204.68 g/mol
SMILES CC1=CC(=C(C=C1)C)S(=O)(=O)Cl
InChIKey FZVZUIBYLZZOEW-UHFFFAOYSA-N
Last Updated: 2025-09-27 16:07

Related Q&A

Compound Q&A

What are the main uses of 2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1)?

2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) is primarily used in organic synthesis, pharm...

Compound Q&A

Is 2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) safe?

2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) is generally safe when handled with proper pr...

Compound Q&A

How should 2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) be stored?

2,5-Dimethylbenzenesulfonyl chloride (CAS: 19040-62-1) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...