Compound Q&A

What are the physical and chemical properties of 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS: 84942-40-5)?

Answer

1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone
1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS: 84942-40-5) has a crystalline form and a molecular weight of approximately 291.04 g/mol. It is poorly soluble in water but soluble in organic solvents. This compound is known for its high reactivity due to the presence of nitro and hydroxy groups. It can undergo various reactions such as reduction, nitration, and esterification.

About

CAS No 84942-40-5
English Name 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone
Molecular Formula C8H6ClNO4
Molecular Weight 215.59 g/mol
SMILES Clc1cc([N+](=O)[O-])c(c(c1)C(=O)C)O
InChIKey IUNBIQBAYUBIFD-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS: 84942-40-5) typically synthesized?

1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS: 84942-40-5) is typically synthesized through the ...

Compound Q&A

What industries use 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS: 84942-40-5)?

1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS: 84942-40-5) is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS: 84942-40-5)?

When handling 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS: 84942-40-5), it is crucial to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...