Compound Q&A

What industries use [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7)?

Answer

[4-(9H-Carbazol-9-yl)phenyl]boronic acid
[4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor in the synthesis of drugs and as a functional monomer in the development of advanced polymers. Additionally, it finds applications in the production of sensors and semiconductors due to its unique chemical properties.

About

English Name [4-(9H-Carbazol-9-yl)phenyl]boronic acid
Molecular Formula C18H14BNO2
Molecular Weight 287.13 g/mol
SMILES B(C1=CC=C(C=C1)N2C3=CC=CC=C3C4=CC=CC=C42)(O)O
InChIKey JGAVTCVHDMOQTJ-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7)?

[4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7) is a white to off-white crystalline soli...

Compound Q&A

How is [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419533-7) typically synthesized?

[4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7) can be synthesized via a multistep proce...

Compound Q&A

What precautions should be taken when handling [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7)?

When handling [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7), it is important to use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...