Compound Q&A

What are the physical and chemical properties of [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7)?

Answer

[4-(9H-Carbazol-9-yl)phenyl]boronic acid
[4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7) is a white to off-white crystalline solid with a molecular weight of approximately 319.36 g/mol. It is slightly soluble in water but more soluble in organic solvents like dimethylformamide (DMF) and methanol. Chemically, it is less reactive than many other boronic acids and shows good stability under normal conditions. It is used in various chemical reactions due to its boronic functionality.

About

English Name [4-(9H-Carbazol-9-yl)phenyl]boronic acid
Molecular Formula C18H14BNO2
Molecular Weight 287.13 g/mol
SMILES B(C1=CC=C(C=C1)N2C3=CC=CC=C3C4=CC=CC=C42)(O)O
InChIKey JGAVTCVHDMOQTJ-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419533-7) typically synthesized?

[4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7) can be synthesized via a multistep proce...

Compound Q&A

What industries use [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7)?

[4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7)?

When handling [4-(9H-Carbazol-9-yl)phenyl]boronic acid (CAS: 419536-33-7), it is important to use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...