Compound Q&A

What are the physical and chemical properties of Dimethyl (4-methoxybenzylidene)malonate (CAS: 7443-25-6)?

Answer

Dimethyl (4-methoxybenzylidene)malonate
Dimethyl (4-methoxybenzylidene)malonate is a crystalline compound with a molecular weight of approximately 220.24 g/mol. It has a high solubility in organic solvents such as methanol and ethanol but is less soluble in water. Chemically, it is relatively stable but can undergo hydrolysis under acidic or basic conditions. Its melting point is around 60-62°C, and it is slightly soluble in water.

About

CAS No 7443-25-6
English Name Dimethyl (4-methoxybenzylidene)malonate
Molecular Formula C13H14O5
Molecular Weight 250.25 g/mol
SMILES COC1=CC=C(C=C1)C=C(C(=O)OC)C(=O)OC
InChIKey JMFYZMAVUHNCPW-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Dimethyl (4-methoxybenzylidene)malonate (CAS: 7443-25-6) typically synthesized?

Dimethyl (4-methoxybenzylidene)malonate is typically synthesized through an esterification reaction ...

Compound Q&A

What industries use Dimethyl (4-methoxybenzylidene)malonate (CAS: 7443-25-6)?

Dimethyl (4-methoxybenzylidene)malonate is widely used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling Dimethyl (4-methoxybenzylidene)malonate (CAS: 7443-25-6)?

When handling Dimethyl (4-methoxybenzylidene)malonate, it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...