Compound Q&A

What industries use Androst-4-ene-3,11,17-trione (CAS: 382-45-6)?

Answer

Androst-4-ene-3,11,17-trione
Androst-4-ene-3,11,17-trione is primarily used in the pharmaceutical industry for the production of steroid hormones and progestogens. It is also utilized in research applications, particularly in the development of new drugs and biochemical studies. Additionally, it can be employed in the polymer industry for synthesizing certain polymers and in the sensor and semiconductor industries for specialized applications.

About

CAS No 382-45-6
English Name Androst-4-ene-3,11,17-trione
Molecular Formula C19H24O3
Molecular Weight 300.4 g/mol
SMILES CC12CCC(=O)C=C1CCC3C2C(=O)CC4(C3CCC4=O)C
InChIKey RZRPTBIGEANTGU-IRIMSJTPSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Androst-4-ene-3,11,17-trione (CAS: 382-45-6)?

Androst-4-ene-3,11,17-trione (CAS: 382-45-6) is a steroidal compound. It is a white crystalline soli...

Compound Q&A

How is Androst-4-ene-3,11,17-trione (CAS: 382-45-6) typically synthesized?

Androst-4-ene-3,11,17-trione can be synthesized via various routes. One common method involves the r...

Compound Q&A

What precautions should be taken when handling Androst-4-ene-3,11,17-trione (CAS: 382-45-6)?

When handling Androst-4-ene-3,11,17-trione (CAS: 382-45-6), it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...